DICHLOROISOPROTERENOL
| SMILES | CC(C)NCC(O)c1ccc(Cl)c(Cl)c1 |
| InChIKey | VKMGSWIFEHZQRS-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 2 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 4 |
| Molecular weight (Da) | 247.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
| Ligand site mutations | β2 |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| β2 | ADRB2 | Bovine | Adrenoceptors | A | pKi | 6.85 | 6.85 | 6.85 | ChEMBL |
| β1 | ADRB1 | Rat | Adrenoceptors | A | pKi | 7.29 | 7.29 | 7.29 | ChEMBL |
| β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 7.0 | 7.0 | 7.0 | PDSP Ki database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| β2 | ADRB2 | Bovine | Adrenoceptors | A | pIC50 | 6.01 | 6.01 | 6.01 | ChEMBL |
| β1 | ADRB1 | Rat | Adrenoceptors | A | pIC50 | 6.94 | 6.94 | 6.94 | ChEMBL |
| β1 | B0FL73 | Guinea pig | Adrenoceptors | A | pIC50 | 6.94 | 6.94 | 6.94 | ChEMBL |
| β2 | ADRB2 | Guinea pig | Adrenoceptors | A | pIC50 | 6.01 | 6.01 | 6.01 | ChEMBL |