compound 2 [PMID: 19230660]
| SMILES | CN1CCCN(CC1)C(=O)c1ccc2c(c1)nc1n2[C@@H](C(C)C)C(=O)Nc2c1cc(cc2)NC1CCCCCC1 |
| InChIKey | MZUNJRMUTJBHGB-LJAQVGFWSA-N |
Chemical properties
| Hydrogen bond acceptors | 6 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 4 |
| Molecular weight (Da) | 542.3 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| MRGPRX2 | MRGX2 | Human | A orphans | A | pEC50 | 6.5 | 6.5 | 6.5 | Guide to Pharmacology |
| MRGPRX2 | MRGX2 | Human | A orphans | A | pEC50 | 6.5 | 6.5 | 6.5 | ChEMBL |