CHEMBL341339
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N1CCC3(C=Cc4ccccc43)CC1)[C@@](O)(CC(=O)O)C2 |
| InChIKey | XKVDTEPESVJNPJ-NGXZDTIWSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 459.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| V1A | V1AR | Rat | Vasopressin and oxytocin | A | pKi | 4.58 | 4.58 | 4.58 | ChEMBL |
| V2 | V2R | Rat | Vasopressin and oxytocin | A | pKi | 4.54 | 4.54 | 4.54 | ChEMBL |
| OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 6.43 | 6.43 | 6.43 | ChEMBL |
| OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 6.28 | 6.28 | 6.28 | ChEMBL |
| V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 5.25 | 5.25 | 5.25 | ChEMBL |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 5.8 | 5.8 | 5.8 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| V2 | V2R | Rat | Vasopressin and oxytocin | A | pIC50 | 4.16 | 4.16 | 4.16 | ChEMBL |
| OT | OXYR | Rat | Vasopressin and oxytocin | A | pIC50 | 6.1 | 6.1 | 6.1 | ChEMBL |