CHEMBL346389
| SMILES | O=C1COc2cc(CN3CCN(c4ccc(Cl)cc4)CC3)ccc2N1 |
| InChIKey | UFFHNEZNXKJHFB-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 3 |
| Molecular weight (Da) | 357.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| α2B | ADA2B | Rat | Adrenoceptors | A | pKi | 6.43 | 6.43 | 6.43 | ChEMBL |
| α1B | ADA1B | Rat | Adrenoceptors | A | pKi | 6.1 | 6.1 | 6.1 | ChEMBL |
| α1B | ADA1B | Human | Adrenoceptors | A | pKi | 6.1 | 6.1 | 6.1 | ChEMBL |
| α1A | ADA1A | Rat | Adrenoceptors | A | pKi | 6.69 | 6.69 | 6.69 | ChEMBL |
| α2B | ADA2B | Human | Adrenoceptors | A | pKi | 6.43 | 6.43 | 6.43 | ChEMBL |
| M5 | ACM5 | Human | Acetylcholine (muscarinic) | A | pKi | 6.02 | 6.02 | 6.02 | ChEMBL |
| D4 | DRD4 | Human | Dopamine | A | pKi | 8.37 | 8.37 | 8.37 | ChEMBL |
| α2A | ADA2A | Human | Adrenoceptors | A | pKi | 6.39 | 6.39 | 6.39 | ChEMBL |
| D3 | DRD3 | Human | Dopamine | A | pKi | 6.17 | 6.17 | 6.17 | ChEMBL |
| 5-HT2A | 5HT2A | Human | 5-Hydroxytryptamine | A | pKi | 5.78 | 5.78 | 5.78 | ChEMBL |
| 5-HT1A | 5HT1A | Human | 5-Hydroxytryptamine | A | pKi | 6.1 | 6.1 | 6.1 | ChEMBL |
| D2 | DRD2 | Human | Dopamine | A | pKi | 6.38 | 6.38 | 6.38 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| α2B | ADA2B | Rat | Adrenoceptors | A | pIC50 | 6.2 | 6.2 | 6.2 | ChEMBL |
| α1B | ADA1B | Rat | Adrenoceptors | A | pIC50 | 5.85 | 5.85 | 5.85 | ChEMBL |
| α1A | ADA1A | Rat | Adrenoceptors | A | pIC50 | 6.3 | 6.3 | 6.3 | ChEMBL |
| M5 | ACM5 | Human | Acetylcholine (muscarinic) | A | pIC50 | 5.87 | 5.87 | 5.87 | ChEMBL |
| α2A | ADA2A | Human | Adrenoceptors | A | pIC50 | 5.96 | 5.96 | 5.96 | ChEMBL |
| 5-HT1A | 5HT1A | Human | 5-Hydroxytryptamine | A | pIC50 | 5.85 | 5.85 | 5.85 | ChEMBL |