MSD-CYP11B2
| SMILES | CC(C)(O)c1cncc(-c2nc3ccc(F)cc3n2C2CC2)c1 |
| InChIKey | OAMLIJKKGZLNHE-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 3 |
| Molecular weight (Da) | 311.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| α2B | ADA2B | Human | Adrenoceptors | A | pKi | 5.84 | 5.84 | 5.84 | ChEMBL |
| α2C | ADA2C | Human | Adrenoceptors | A | pKi | 6.2 | 6.2 | 6.2 | ChEMBL |
| β1 | ADRB1 | Human | Adrenoceptors | A | pKi | 5.62 | 5.62 | 5.62 | ChEMBL |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pKi | 5.81 | 5.81 | 5.81 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| α2B | ADA2B | Human | Adrenoceptors | A | pIC50 | 5.33 | 5.33 | 5.33 | ChEMBL |
| β1 | ADRB1 | Human | Adrenoceptors | A | pIC50 | 5.02 | 5.02 | 5.02 | ChEMBL |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pIC50 | 5.27 | 5.27 | 5.27 | ChEMBL |