CHEMBL367958
| SMILES | CCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC |
| InChIKey | DNIIBGYNGASUDE-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 12 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 14 |
| Molecular weight (Da) | 636.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| ETB | EDNRB | Rat | Endothelin | A | pKd | 6.36 | 6.36 | 6.36 | ChEMBL |
| ETA | EDNRA | Rat | Endothelin | A | pKd | 7.02 | 7.02 | 7.02 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| ETB | EDNRB | Human | Endothelin | A | pIC50 | 6.91 | 6.91 | 6.91 | ChEMBL |
| ETA | EDNRA | Human | Endothelin | A | pIC50 | 7.72 | 7.72 | 7.72 | ChEMBL |