CHEMBL3940429
| SMILES | COc1cc(OC2CCC2)cc(-c2ccc3c(c2)CC[C@H](CCC(=O)O)O3)c1F |
| InChIKey | SUNJVOYOIHKMKX-QGZVFWFLSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 7 |
| Molecular weight (Da) | 400.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| FFA4 | FFAR4 | Human | Free fatty acid | A | pEC50 | 7.82 | 7.94 | 8.05 | ChEMBL |