CHEMBL121571
| SMILES | CSCC[C@@H]1NC[C@@H](CC(C)C)NC(=O)CCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CCC(N)=O)NC1=O |
| InChIKey | LYIZVKRYLGRVLP-ZIBKNMLNSA-N |
Chemical properties
| Hydrogen bond acceptors | 8 |
| Hydrogen bond donors | 8 |
| Rotatable bonds | 12 |
| Molecular weight (Da) | 762.4 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| NK2 | NK2R | Golden hamster | Tachykinin | A | pKd | 7.89 | 7.89 | 7.89 | ChEMBL |
| NK2 | NK2R | Rabbit | Tachykinin | A | pKd | 6.65 | 6.65 | 6.65 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |