CHEMBL4099470
| SMILES | COc1ccccc1C(=O)N[C@H]1C[C@@](N)(C(=O)O)[C@@H]2[C@@H](C(=O)O)[C@H]12 |
| InChIKey | RZEDXUFBIJSIMV-SWKDTAOHSA-N |
Chemical properties
| Hydrogen bond acceptors | 5 |
| Hydrogen bond donors | 4 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 334.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pKi | 7.63 | 7.63 | 7.63 | ChEMBL |
| mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.82 | 6.82 | 6.82 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pEC50 | 8.15 | 8.15 | 8.15 | ChEMBL |
| mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pEC50 | 7.58 | 7.58 | 7.58 | ChEMBL |