CHEMBL4173095
| SMILES | C=C(C)CN1CCN(c2ccc3c(c2)CN(C(=O)OCc2ccccc2)CC3)CC1 |
| InChIKey | BOIPWYRNMCLWCD-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 405.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| 5-HT1E | 5HT1E | Human | 5-Hydroxytryptamine | A | pKi | 5.91 | 5.91 | 5.91 | ChEMBL |
| α2B | ADA2B | Human | Adrenoceptors | A | pKi | 5.61 | 5.61 | 5.61 | ChEMBL |
| H2 | HRH2 | Human | Histamine | A | pKi | 6.01 | 6.01 | 6.01 | ChEMBL |
| H1 | HRH1 | Human | Histamine | A | pKi | 6.06 | 6.06 | 6.06 | ChEMBL |
| α2A | ADA2A | Human | Adrenoceptors | A | pKi | 6.06 | 6.06 | 6.06 | ChEMBL |
| H3 | HRH3 | Human | Histamine | A | pKi | 5.55 | 5.55 | 5.55 | ChEMBL |
| 5-HT2C | 5HT2C | Human | 5-Hydroxytryptamine | A | pKi | 5.87 | 5.87 | 5.87 | ChEMBL |
| D3 | DRD3 | Human | Dopamine | A | pKi | 6.58 | 6.58 | 6.58 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |