MIFEPRISTONE
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)C)cc3)C[C@@]21C |
| InChIKey | VKHAHZOOUSRJNA-GCNJZUOMSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 2 |
| Molecular weight (Da) | 429.3 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| α2B | ADA2B | Human | Adrenoceptors | A | pKi | 4.92 | 4.92 | 4.92 | ChEMBL |
| κ | OPRK | Human | Opioid | A | pKi | 5.09 | 5.09 | 5.09 | ChEMBL |
| μ | OPRM | Human | Opioid | A | pKi | 6.0 | 6.0 | 6.0 | ChEMBL |
| α2B | ADA2B | Human | Adrenoceptors | A | pKi | 8.31 | 8.31 | 8.31 | Drug Central |
| κ | OPRK | Human | Opioid | A | pKi | 8.29 | 8.29 | 8.29 | Drug Central |
| μ | OPRM | Human | Opioid | A | pKi | 8.22 | 8.22 | 8.22 | Drug Central |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| α2B | ADA2B | Human | Adrenoceptors | A | pIC50 | 4.58 | 4.58 | 4.58 | ChEMBL |
| NPS | NPSR1 | Human | Neuropeptide S | A | Potency | 4.9 | 4.9 | 4.9 | ChEMBL |
| κ | OPRK | Human | Opioid | A | pIC50 | 4.7 | 4.7 | 4.7 | ChEMBL |
| μ | OPRM | Human | Opioid | A | pIC50 | 5.61 | 5.61 | 5.61 | ChEMBL |