hydrocodone
| SMILES | COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@@H]4CCC1=O)C |
| InChIKey | LLPOLZWFYMWNKH-CMKMFDCUSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 1 |
| Molecular weight (Da) | 299.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| κ | OPRK | Human | Opioid | A | pKi | 6.58 | 6.58 | 6.58 | ChEMBL |
| μ | OPRM | Human | Opioid | A | pKi | 8.02 | 8.02 | 8.02 | ChEMBL |
| κ | OPRK | Human | Opioid | A | pKi | 8.18 | 8.18 | 8.18 | Drug Central |
| κ | OPRK | Human | Opioid | A | pKi | 6.59 | 6.59 | 6.59 | Guide to Pharmacology |
| μ | OPRM | Human | Opioid | A | pKi | 8.1 | 8.1 | 8.1 | Drug Central |
| μ | OPRM | Human | Opioid | A | pKi | 8.7 | 8.7 | 8.7 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |