CHEMBL97200
| SMILES | CC(C)C[C@@H]1[C@H](C(=O)O)[C@H]1C(N)(CC1c2ccccc2Oc2ccccc21)C(=O)O |
| InChIKey | RQZMFVKQWUAIHP-CHYAVIAWSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 3 |
| Rotatable bonds | 7 |
| Molecular weight (Da) | 409.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu8 | GRM8 | Human | Metabotropic glutamate | C | pIC50 | 6.42 | 6.42 | 6.42 | ChEMBL |
| mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pIC50 | 5.58 | 5.58 | 5.58 | ChEMBL |
| mGlu3 | GRM3 | Rat | Metabotropic glutamate | C | pIC50 | 7.4 | 7.4 | 7.4 | ChEMBL |
| mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pIC50 | 5.86 | 5.86 | 5.86 | ChEMBL |
| mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pIC50 | 5.06 | 5.06 | 5.06 | ChEMBL |