CHEMBL413573
| SMILES | CCCC[C@@H]1NC(=O)CC[C@@H](C(N)=O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](Cc2ccc3ccccc3c2)NC(=O)[C@H](C(C)C)NC1=O |
| InChIKey | GVZTZLFKKLVBJF-JDABYTJISA-N |
Chemical properties
| Hydrogen bond acceptors | None |
| Hydrogen bond donors | None |
| Rotatable bonds | None |
| Molecular weight (Da) |
Drug properties
| Molecular type | Protein |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| MC5 | MC5R | Human | Melanocortin | A | pKd | 8.7 | 8.7 | 8.7 | ChEMBL |
| MC3 | MC3R | Human | Melanocortin | A | pKd | 8.4 | 8.4 | 8.4 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| MC1 | MSHR | Human | Melanocortin | A | pIC50 | 5.4 | 5.4 | 5.4 | ChEMBL |
| MC5 | MC5R | Human | Melanocortin | A | pIC50 | 8.66 | 8.66 | 8.66 | ChEMBL |
| MC3 | MC3R | Human | Melanocortin | A | pIC50 | 8.77 | 8.77 | 8.77 | ChEMBL |
| MC4 | MC4R | Human | Melanocortin | A | pEC50 | 7.8 | 7.8 | 7.8 | ChEMBL |
| MC4 | MC4R | Human | Melanocortin | A | pIC50 | 6.75 | 6.75 | 6.75 | ChEMBL |