CHEMBL4777443
| SMILES | CC(C)(C)OC(=O)N1CCCC1CN[C@H]1CC[C@@](c2cc(F)ccc2F)(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChIKey | TTWGDSSADVBNQY-LMGRWQENSA-N |
Chemical properties
| Hydrogen bond acceptors | None |
| Hydrogen bond donors | None |
| Rotatable bonds | None |
| Molecular weight (Da) |
Drug properties
| Molecular type | Na |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| 5-HT1B | 5HT1B | Human | 5-Hydroxytryptamine | A | pKi | 6.02 | 6.02 | 6.02 | ChEMBL |
| 5-HT1D | 5HT1D | Human | 5-Hydroxytryptamine | A | pKi | 6.63 | 6.63 | 6.63 | ChEMBL |
| α2B | ADA2B | Human | Adrenoceptors | A | pKi | 6.06 | 6.06 | 6.06 | ChEMBL |
| α2C | ADA2C | Human | Adrenoceptors | A | pKi | 6.18 | 6.18 | 6.18 | ChEMBL |
| H2 | HRH2 | Human | Histamine | A | pKi | 5.42 | 5.42 | 5.42 | ChEMBL |
| 5-HT7 | 5HT7R | Human | 5-Hydroxytryptamine | A | pKi | 6.08 | 6.08 | 6.08 | ChEMBL |
| α2A | ADA2A | Human | Adrenoceptors | A | pKi | 6.62 | 6.62 | 6.62 | ChEMBL |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pKi | 7.68 | 7.68 | 7.68 | ChEMBL |
| 5-HT2C | 5HT2C | Human | 5-Hydroxytryptamine | A | pKi | 6.29 | 6.29 | 6.29 | ChEMBL |
| D3 | DRD3 | Human | Dopamine | A | pKi | 6.15 | 6.15 | 6.15 | ChEMBL |
| 5-HT2A | 5HT2A | Human | 5-Hydroxytryptamine | A | pKi | 6.32 | 6.32 | 6.32 | ChEMBL |
| 5-HT1A | 5HT1A | Human | 5-Hydroxytryptamine | A | pKi | 5.56 | 5.56 | 5.56 | ChEMBL |
| κ | OPRK | Human | Opioid | A | pKi | 5.48 | 5.48 | 5.48 | ChEMBL |
| D2 | DRD2 | Human | Dopamine | A | pKi | 5.91 | 5.91 | 5.91 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |