N4-phenylethoxycytidine-5'-triphosphate
| SMILES | O[C@@H]1[C@H](O)[C@H](O[C@H]1n1cc/c(=N/OCCc2ccccc2)/[nH]c1=O)COP(=O)(OP(=O)(OP(=O)(O)O)O)O |
| InChIKey | WREOTYWODABZMH-DTZQCDIJSA-N |
Chemical properties
| Hydrogen bond acceptors | 13 |
| Hydrogen bond donors | 7 |
| Rotatable bonds | 12 |
| Molecular weight (Da) | 603.0 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| P2Y2 | P2RY2 | Human | P2Y | A | pEC50 | 5.92 | 5.92 | 5.92 | ChEMBL |
| P2Y4 | P2RY4 | Human | P2Y | A | pEC50 | 7.14 | 7.14 | 7.14 | ChEMBL |
| P2Y4 | P2RY4 | Human | P2Y | A | pEC50 | 7.14 | 7.14 | 7.14 | Guide to Pharmacology |
| P2Y6 | P2RY6 | Human | P2Y | A | pEC50 | 5.92 | 5.92 | 5.92 | ChEMBL |