R121919
| SMILES | CCCN(c1cc(C)nc2n1nc(c2c1cnc(cc1C)N(C)C)C)CCC |
| InChIKey | ANNRUWYFVIGKHA-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 6 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 7 |
| Molecular weight (Da) | 380.3 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
| Ligand site mutations | CRF1 |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| CRF1 | CRFR1 | Human | Corticotropin-releasing factor | B1 | pKi | 8.3 | 8.65 | 9.0 | Guide to Pharmacology |
| CRF1 | CRFR1 | Rat | Corticotropin-releasing factor | B1 | pKi | 8.42 | 8.42 | 8.42 | ChEMBL |
| CRF1 | CRFR1 | Human | Corticotropin-releasing factor | B1 | pKi | 7.92 | 8.34 | 8.59 | ChEMBL |
| CRF1 | CRFR1 | Human | Corticotropin-releasing factor | B1 | pKd | 9.52 | 9.52 | 9.52 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| CRF1 | CRFR1 | Human | Corticotropin-releasing factor | B1 | pIC50 | 7.17 | 7.65 | 8.4 | ChEMBL |