S26284
| SMILES | CC(=O)NCCc1cccc2c1cc(OCCCCOc1ccc3c(c1)c(CCNC(=O)C)ccc3)cc2 |
| InChIKey | AGGOYESCDGTCOY-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 13 |
| Molecular weight (Da) | 512.3 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| MT2 | MTR1B | Human | Melatonin | A | pKi | 6.8 | 7.0 | 7.2 | Guide to Pharmacology |
| MT2 | MTR1B | Human | Melatonin | A | pKi | 6.78 | 7.06 | 7.14 | ChEMBL |
| MT1 | MTR1A | Human | Melatonin | A | pKi | 8.51 | 9.08 | 9.22 | ChEMBL |
| MT1 | MTR1A | Human | Melatonin | A | pKi | 8.5 | 8.85 | 9.2 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| MT2 | MTR1B | Human | Melatonin | A | pEC50 | 6.39 | 6.39 | 6.39 | ChEMBL |
| MT1 | MTR1A | Human | Melatonin | A | pEC50 | 7.14 | 7.14 | 7.14 | ChEMBL |