SIB-1757
| SMILES | Cc1ccc(c(n1)/N=N/c1ccccc1)O |
| InChIKey | LOCPVWIREQIGNQ-CCEZHUSRSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 2 |
| Molecular weight (Da) | 213.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pKi | 6.43 | 6.43 | 6.43 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 6.0 | 6.2 | 6.4 | Guide to Pharmacology |
| M1 | ACM1 | Rat | Acetylcholine (muscarinic) | A | Potency | 5.35 | 5.35 | 5.35 | ChEMBL |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 5.93 | 5.93 | 5.93 | ChEMBL |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 6.43 | 6.43 | 6.43 | ChEMBL |