VU6010608
| SMILES | COc1ccc(cc1OC)C(=O)Nc1cc(ccc1n1ncnc1)OC(F)(F)F |
| InChIKey | YCDOKDADFOBKIL-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 7 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 6 |
| Molecular weight (Da) | 408.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu7 | GRM7 | Rat | Metabotropic glutamate | C | pIC50 | 6.12 | 6.12 | 6.12 | Guide to Pharmacology |
| mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pIC50 | 6.15 | 6.18 | 6.2 | ChEMBL |
| mGlu7 | GRM7 | Rat | Metabotropic glutamate | C | pIC50 | 6.1 | 6.12 | 6.12 | ChEMBL |