apafant
| SMILES | O=C(N1CCOCC1)CCc1sc2c(c1)C(=NCc1n2c(C)nn1)c1ccccc1Cl |
| InChIKey | JGPJQFOROWSRRS-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 7 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 4 |
| Molecular weight (Da) | 455.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| PAF | PTAFR | Human | Platelet-activating factor | A | pKi | 5.2 | 6.35 | 7.5 | Guide to Pharmacology |
| PAF | PTAFR | Human | Platelet-activating factor | A | pKd | 7.4 | 7.7 | 8.0 | Guide to Pharmacology |
| PAF | PTAFR | Guinea pig | Platelet-activating factor | A | pKi | 7.01 | 7.39 | 8.15 | ChEMBL |
| PAF | PTAFR | Human | Platelet-activating factor | A | pKi | 7.1 | 7.38 | 7.63 | PDSP Ki database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| PAF | PTAFR | Guinea pig | Platelet-activating factor | A | pIC50 | 6.84 | 6.97 | 7.04 | ChEMBL |
| PAF | PTAFR | Human | Platelet-activating factor | A | pIC50 | 6.7 | 6.97 | 7.4 | ChEMBL |