CHEMBL1076865
| SMILES | N[C@@H](CCP(=O)(O)CC(Cl)C(=O)O)C(=O)O |
| InChIKey | FQUOPRSIELVFTB-AKGZTFGVSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 4 |
| Rotatable bonds | 7 |
| Molecular weight (Da) | 273.0 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pEC50 | 5.05 | 5.05 | 5.05 | ChEMBL |
| mGlu8 | GRM8 | Rat | Metabotropic glutamate | C | pEC50 | 5.08 | 5.08 | 5.09 | ChEMBL |
| mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 5.42 | 5.71 | 6.0 | ChEMBL |
| mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pEC50 | 4.31 | 4.31 | 4.31 | ChEMBL |