CHEMBL178741
| SMILES | CO[C@H]1CC[C@@H](C(=O)c2ccc3nc4c(cc3c2)CCCCC4)CC1 |
| InChIKey | NPOBWKADZAGENT-GLRZTSSQSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 3 |
| Molecular weight (Da) | 337.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pIC50 | 7.1 | 7.1 | 7.1 | ChEMBL |
| mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 7.75 | 7.75 | 7.75 | ChEMBL |