CHEMBL182567
| SMILES | CCCN(CCC)c1cc(C)nc2c(-c3ncc(C)cc3[N+](=O)[O-])c(C)nn12 |
| InChIKey | UWELGZCFOYQOQP-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 7 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 7 |
| Molecular weight (Da) | 382.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| CRF1 | CRFR1 | Human | Corticotropin-releasing factor | B1 | pKi | 7.85 | 7.85 | 7.85 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |