CHEMBL1907858
| SMILES | O=C1NCN(c2ccccc2)C12CCN([C@H]1Cc3cccc4cccc1c34)CC2 |
| InChIKey | BBOAHBVXCYBKLC-QFIPXVFZSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 2 |
| Molecular weight (Da) | 383.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| NOP | OPRX | Human | Opioid | A | pKi | 8.7 | 8.99 | 9.28 | ChEMBL |
| κ | OPRK | Human | Opioid | A | pKi | 7.6 | 7.6 | 7.6 | ChEMBL |
| μ | OPRM | Human | Opioid | A | pKi | 7.9 | 8.07 | 8.23 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| NOP | OPRX | Human | Opioid | A | pEC50 | 7.4 | 7.4 | 7.4 | ChEMBL |