(2R,3R)-APDC
| SMILES | OC(=O)[C@@H]1NC[C@@](C1)(N)C(=O)O |
| InChIKey | XZFMJVJDSYRWDQ-AWFVSMACSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 4 |
| Rotatable bonds | 2 |
| Molecular weight (Da) | 174.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
| mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pKi | 5.3 | 5.3 | 5.3 | Guide to Pharmacology |
| mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.35 | 6.35 | 6.35 | ChEMBL |
| mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pKi | 6.39 | 6.39 | 6.39 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pEC50 | 4.0 | 4.0 | 4.0 | ChEMBL |
| mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pEC50 | 6.32 | 6.51 | 6.7 | ChEMBL |
| mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pEC50 | 5.52 | 5.52 | 5.52 | ChEMBL |
| mGlu3 | GRM3 | Rat | Metabotropic glutamate | C | pEC50 | 5.77 | 5.77 | 5.77 | ChEMBL |