CHEMBL2092996
| SMILES | COc1cc(C[C@H]2NCCc3cc(O)c(O)c(F)c32)cc(OC)c1OC |
| InChIKey | MKRDKFSQEPQZSX-GFCCVEGCSA-N |
Chemical properties
| Hydrogen bond acceptors | 6 |
| Hydrogen bond donors | 3 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 363.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| β1 | B0FL73 | Guinea pig | Adrenoceptors | A | pKi | 5.94 | 5.94 | 5.94 | ChEMBL |
| β2 | ADRB2 | Guinea pig | Adrenoceptors | A | pKi | 6.43 | 6.43 | 6.43 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| β1 | B0FL73 | Guinea pig | Adrenoceptors | A | pEC50 | 5.22 | 5.22 | 5.22 | ChEMBL |
| β2 | ADRB2 | Guinea pig | Adrenoceptors | A | pEC50 | 5.45 | 5.45 | 5.45 | ChEMBL |
| TP | TA2R | Human | Prostanoid | A | pIC50 | 5.61 | 5.61 | 5.61 | ChEMBL |