CAY10583
| SMILES | CCCCC(=O)N(c1ccccc1)Cc1ccc(cc1)c1ccccc1C(=O)O |
| InChIKey | IUJTVDNJFPZYBL-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 2 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 8 |
| Molecular weight (Da) | 387.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| BLT2 | LT4R2 | Mouse | Leukotriene | A | pKi | 8.52 | 8.52 | 8.52 | Guide to Pharmacology |
| BLT2 | LT4R2 | Human | Leukotriene | A | pKd | 7.83 | 7.83 | 7.83 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| BLT2 | LT4R2 | Human | Leukotriene | A | pEC50 | 7.7 | 7.7 | 7.7 | Guide to Pharmacology |
| BLT2 | LT4R2 | Human | Leukotriene | A | pEC50 | 7.54 | 7.54 | 7.54 | ChEMBL |