3,3'-difluorobenzaldazine
| SMILES | Fc1cccc(c1)/C=N/N=C/c1cccc(c1)F |
| InChIKey | YYMCVDNIIFNDJK-BEQMOXJMSA-N |
Chemical properties
| Hydrogen bond acceptors | 2 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 3 |
| Molecular weight (Da) | 244.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
| Ligand site mutations | mGlu5 |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 5.6 | 7.05 | 8.5 | Guide to Pharmacology |
| M5 | ACM5 | Human | Acetylcholine (muscarinic) | A | pEC50 | 5.58 | 5.58 | 5.58 | ChEMBL |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pEC50 | 5.58 | 7.11 | 8.63 | ChEMBL |