CHEMBL263350
| SMILES | CC(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N1Cc2ccccc2CC1C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(N)=O)[C@@H](C)O)C(C)C |
| InChIKey | UFSMQYWCIRNYRR-RDTSJQGISA-N |
Chemical properties
| Hydrogen bond acceptors | 25 |
| Hydrogen bond donors | 27 |
| Rotatable bonds | 59 |
| Molecular weight (Da) | 1926.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Y2 | Q9ERC0 | Rat | Neuropeptide Y | A | pIC50 | 8.47 | 8.47 | 8.47 | ChEMBL |
| Y2 | NPY2R | Human | Neuropeptide Y | A | pIC50 | 6.73 | 6.73 | 6.73 | ChEMBL |