DEXPROPRANOLOL
| SMILES | CC(C)NC[C@@H](O)COc1cccc2ccccc12 |
| InChIKey | AQHHHDLHHXJYJD-CQSZACIVSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 6 |
| Molecular weight (Da) | 259.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| β1 | ADRB1 | Human | Adrenoceptors | A | pKi | 6.67 | 6.67 | 6.67 | ChEMBL |
| 5-HT1A | 5HT1A | Rat | 5-Hydroxytryptamine | A | pKi | 5.55 | 5.66 | 5.77 | ChEMBL |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pKi | 6.55 | 6.55 | 6.55 | ChEMBL |
| β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 7.28 | 7.28 | 7.28 | ChEMBL |
| β1 | ADRB1 | Rat | Adrenoceptors | A | pKi | 7.09 | 7.09 | 7.09 | PDSP Ki database |
| 5-HT1B | 5HT1B | Rat | 5-Hydroxytryptamine | A | pKi | 5.15 | 5.15 | 5.15 | PDSP Ki database |
| β2 | ADRB2 | Rat | Adrenoceptors | A | pKi | 7.36 | 7.36 | 7.36 | PDSP Ki database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| 5-HT1B | 5HT1B | Rat | 5-Hydroxytryptamine | A | pIC50 | 6.31 | 6.31 | 6.31 | ChEMBL |
| M1 | ACM1 | Rat | Acetylcholine (muscarinic) | A | Potency | 6.35 | 6.45 | 6.55 | ChEMBL |
| β1 | ADRB1 | Human | Adrenoceptors | A | pIC50 | 6.43 | 6.43 | 6.43 | ChEMBL |
| 5-HT1A | 5HT1A | Rat | 5-Hydroxytryptamine | A | pIC50 | 5.31 | 6.04 | 6.77 | ChEMBL |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pIC50 | 6.36 | 6.36 | 6.36 | ChEMBL |
| β2 | ADRB2 | Human | Adrenoceptors | A | pIC50 | 7.12 | 7.12 | 7.12 | ChEMBL |
| TSH | TSHR | Human | Glycoprotein hormone | A | Potency | 5.3 | 5.3 | 5.3 | ChEMBL |