Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| #Vendors | Reference ligand
| Fold selectivity | # Tested GPCRs | Species
| p-value (-log) | Activity Type
| Activity Relation
| Activity Value
| AssayType
| Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Assay information
| Chemical information
| ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| #Vendors | Reference ligand
| Fold selectivity | # Tested GPCRs | Species
| p-value (-log) | Activity Type
| Activity Relation
| Activity Value
| AssayType
| Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
| 3934 | 3318 | 0 | None | -6 | 2 | Human | 11.1 | pEC50 | = | 11.1 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | |
| 4356 | 3318 | 0 | None | -6 | 2 | Human | 11.1 | pEC50 | = | 11.1 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | |
| 73755062 | 3318 | 0 | None | -6 | 2 | Human | 11.1 | pEC50 | = | 11.1 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | |
| 5555 | 3417 | 0 | None | -1 | 2 | Human | 11.3 | pEC50 | = | 11.3 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 390 | 14 | 3 | 5 | 3.6 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](C/C=C\CCC(=O)OC)O)O)O | 22449948 | |
| 71519431 | 3417 | 0 | None | -1 | 2 | Human | 11.3 | pEC50 | = | 11.3 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 390 | 14 | 3 | 5 | 3.6 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](C/C=C\CCC(=O)OC)O)O)O | 22449948 | |
| 1034 | 2392 | 27 | None | 10 | 2 | Human | 9.7 | pEC50 | = | 9.7 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 352 | 14 | 4 | 4 | 3.1 | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O | 20080636 | |
| 5280914 | 2392 | 27 | None | 10 | 2 | Human | 9.7 | pEC50 | = | 9.7 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 352 | 14 | 4 | 4 | 3.1 | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O | 20080636 | |
| CHEMBL392438 | 2392 | 27 | None | 10 | 2 | Human | 9.7 | pEC50 | = | 9.7 | Functional | UnclassifiedUnclassified |
Guide to Pharmacology | 352 | 14 | 4 | 4 | 3.1 | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O | 20080636 | |
Showing 1 to 8 of 8 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Similar- ity
| Common name
| GPCRdb ID | #Vendors
| Reference ligand | Fold selectivity | # Tested GPCRs
| Species | p-value (-log)
| Activity Type
| Activity Relation
| Activity Value
| Assay Type
| Assay Description
| Source | Mol weight | Rot Bonds | H don | H acc | LogP
| Smiles
| DOI |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Assay information
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Similar- ity
| Common name
| GPCRdb ID | #Vendors
| Reference ligand | Fold selectivity | # Tested GPCRs
| Species | p-value (-log)
| Activity Type
| Activity Relation
| Activity Value
| Assay Type
| Assay Description
| Source | Mol weight | Rot Bonds | H don | H acc | LogP
| Smiles
| DOI |
| 3934 | 3318 | 0 | None | - | 1 | Human | 9.7 | pKd | = | 9.7 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
| 4356 | 3318 | 0 | None | - | 1 | Human | 9.7 | pKd | = | 9.7 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
| 73755062 | 3318 | 0 | None | - | 1 | Human | 9.7 | pKd | = | 9.7 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
Showing 1 to 3 of 3 entries