Ligand source activities (1 row/activity)
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| #Vendors | Reference ligand
| Fold selectivity | # Tested GPCRs | Species
| p-value (-log) | Activity Type
| Activity Relation
| Activity Value
| AssayType
| Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Assay information
| Chemical information
| ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| #Vendors | Reference ligand
| Fold selectivity | # Tested GPCRs | Species
| p-value (-log) | Activity Type
| Activity Relation
| Activity Value
| AssayType
| Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
44314644 | 13510 | 0 | None | - | 1 | Rat | 9.1 | pEC50 | = | 9.1 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 533 | 10 | 2 | 5 | 4.2 | CCOC(=O)C[C@@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1193573 | 13510 | 0 | None | - | 1 | Rat | 9.1 | pEC50 | = | 9.1 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 533 | 10 | 2 | 5 | 4.2 | CCOC(=O)C[C@@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL545002 | 13510 | 0 | None | - | 1 | Rat | 9.1 | pEC50 | = | 9.1 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 533 | 10 | 2 | 5 | 4.2 | CCOC(=O)C[C@@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
44314965 | 12914 | 0 | None | - | 1 | Rat | 9.0 | pEC50 | = | 9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 533 | 10 | 2 | 5 | 4.2 | CCOC(=O)C[C@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1189070 | 12914 | 0 | None | - | 1 | Rat | 9.0 | pEC50 | = | 9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 533 | 10 | 2 | 5 | 4.2 | CCOC(=O)C[C@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL538008 | 12914 | 0 | None | - | 1 | Rat | 9.0 | pEC50 | = | 9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 533 | 10 | 2 | 5 | 4.2 | CCOC(=O)C[C@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
9937590 | 108026 | 0 | None | - | 1 | Rat | 9.0 | pEC50 | = | 9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 519 | 9 | 2 | 5 | 3.8 | CCOC(=O)[C@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL319460 | 108026 | 0 | None | - | 1 | Rat | 9.0 | pEC50 | = | 9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 519 | 9 | 2 | 5 | 3.8 | CCOC(=O)[C@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL545465 | 108026 | 0 | None | - | 1 | Rat | 9.0 | pEC50 | = | 9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 519 | 9 | 2 | 5 | 3.8 | CCOC(=O)[C@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
44314574 | 12913 | 0 | None | - | 1 | Rat | 8.9 | pEC50 | = | 8.9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 547 | 11 | 2 | 5 | 4.6 | CCOC(=O)CCC1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1189066 | 12913 | 0 | None | - | 1 | Rat | 8.9 | pEC50 | = | 8.9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 547 | 11 | 2 | 5 | 4.6 | CCOC(=O)CCC1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL538004 | 12913 | 0 | None | - | 1 | Rat | 8.9 | pEC50 | = | 8.9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 547 | 11 | 2 | 5 | 4.6 | CCOC(=O)CCC1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
178024 | 1971 | 33 | None | -1 | 3 | Rat | 8.8 | pEC50 | = | 8.8 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 528 | 8 | 2 | 6 | 1.8 | O=C([C@H](NC(=O)C(N)(C)C)COCc1ccccc1)N1CCC2(CC1)CN(c1c2cccc1)S(=O)(=O)C | 10.1016/S0960-894X(97)00421-6 | |
5867 | 1971 | 33 | None | -1 | 3 | Rat | 8.8 | pEC50 | = | 8.8 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 528 | 8 | 2 | 6 | 1.8 | O=C([C@H](NC(=O)C(N)(C)C)COCc1ccccc1)N1CCC2(CC1)CN(c1c2cccc1)S(=O)(=O)C | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL13817 | 1971 | 33 | None | -1 | 3 | Rat | 8.8 | pEC50 | = | 8.8 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 528 | 8 | 2 | 6 | 1.8 | O=C([C@H](NC(=O)C(N)(C)C)COCc1ccccc1)N1CCC2(CC1)CN(c1c2cccc1)S(=O)(=O)C | 10.1016/S0960-894X(97)00421-6 | |
22867267 | 13698 | 0 | None | - | 1 | Rat | 8.7 | pEC50 | = | 8.7 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 505 | 9 | 3 | 4 | 3.8 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@@H](CC(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1194874 | 13698 | 0 | None | - | 1 | Rat | 8.7 | pEC50 | = | 8.7 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 505 | 9 | 3 | 4 | 3.8 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@@H](CC(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL553478 | 13698 | 0 | None | - | 1 | Rat | 8.7 | pEC50 | = | 8.7 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 505 | 9 | 3 | 4 | 3.8 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@@H](CC(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
44293557 | 101088 | 0 | None | -1 | 2 | Rat | 8.0 | pEC50 | = | 8 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 447 | 7 | 2 | 3 | 3.7 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CCc3ccccc32)CC1 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL294923 | 101088 | 0 | None | -1 | 2 | Rat | 8.0 | pEC50 | = | 8 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 447 | 7 | 2 | 3 | 3.7 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CCc3ccccc32)CC1 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL540001 | 101088 | 0 | None | -1 | 2 | Rat | 8.0 | pEC50 | = | 8 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 447 | 7 | 2 | 3 | 3.7 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CCc3ccccc32)CC1 | 10.1016/S0960-894X(97)00421-6 | |
9890375 | 98270 | 0 | None | -1 | 3 | Rat | 7.9 | pEC50 | = | 7.9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 458 | 5 | 3 | 3 | 3.4 | CC(C)(N)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCC2(CCc3ccccc32)CC1 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL274599 | 98270 | 0 | None | -1 | 3 | Rat | 7.9 | pEC50 | = | 7.9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 458 | 5 | 3 | 3 | 3.4 | CC(C)(N)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCC2(CCc3ccccc32)CC1 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL558802 | 98270 | 0 | None | -1 | 3 | Rat | 7.9 | pEC50 | = | 7.9 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 458 | 5 | 3 | 3 | 3.4 | CC(C)(N)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCC2(CCc3ccccc32)CC1 | 10.1016/S0960-894X(97)00421-6 | |
10026738 | 162769 | 0 | None | -1 | 2 | Rat | 7.8 | pEC50 | = | 7.8 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 449 | 7 | 2 | 4 | 2.9 | CC(C)(N)C(=O)N[C@H](COCc1ccccc1)C(=O)N1CCC2(CCc3ccccc32)CC1 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL417182 | 162769 | 0 | None | -1 | 2 | Rat | 7.8 | pEC50 | = | 7.8 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 449 | 7 | 2 | 4 | 2.9 | CC(C)(N)C(=O)N[C@H](COCc1ccccc1)C(=O)N1CCC2(CCc3ccccc32)CC1 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL557206 | 162769 | 0 | None | -1 | 2 | Rat | 7.8 | pEC50 | = | 7.8 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 449 | 7 | 2 | 4 | 2.9 | CC(C)(N)C(=O)N[C@H](COCc1ccccc1)C(=O)N1CCC2(CCc3ccccc32)CC1 | 10.1016/S0960-894X(97)00421-6 | |
44315065 | 13491 | 0 | None | - | 1 | Rat | 8.7 | pEC50 | = | 8.7 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 519 | 9 | 2 | 5 | 3.8 | CCOC(=O)[C@@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1193375 | 13491 | 0 | None | - | 1 | Rat | 8.7 | pEC50 | = | 8.7 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 519 | 9 | 2 | 5 | 3.8 | CCOC(=O)[C@@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL544769 | 13491 | 0 | None | - | 1 | Rat | 8.7 | pEC50 | = | 8.7 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 519 | 9 | 2 | 5 | 3.8 | CCOC(=O)[C@@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
44314651 | 13604 | 0 | None | - | 1 | Rat | 8.7 | pEC50 | = | 8.7 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 491 | 8 | 3 | 4 | 3.4 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@H](C(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1194179 | 13604 | 0 | None | - | 1 | Rat | 8.7 | pEC50 | = | 8.7 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 491 | 8 | 3 | 4 | 3.4 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@H](C(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL545704 | 13604 | 0 | None | - | 1 | Rat | 8.7 | pEC50 | = | 8.7 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 491 | 8 | 3 | 4 | 3.4 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@H](C(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
22867284 | 13109 | 0 | None | - | 1 | Rat | 8.6 | pEC50 | = | 8.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 505 | 9 | 3 | 4 | 3.8 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@H](CC(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1190399 | 13109 | 0 | None | - | 1 | Rat | 8.6 | pEC50 | = | 8.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 505 | 9 | 3 | 4 | 3.8 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@H](CC(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL540805 | 13109 | 0 | None | - | 1 | Rat | 8.6 | pEC50 | = | 8.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 505 | 9 | 3 | 4 | 3.8 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@H](CC(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
22867266 | 13108 | 0 | None | - | 1 | Rat | 8.6 | pEC50 | = | 8.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 519 | 10 | 3 | 4 | 4.1 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)CC(CCC(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1190394 | 13108 | 0 | None | - | 1 | Rat | 8.6 | pEC50 | = | 8.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 519 | 10 | 3 | 4 | 4.1 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)CC(CCC(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL540800 | 13108 | 0 | None | - | 1 | Rat | 8.6 | pEC50 | = | 8.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 519 | 10 | 3 | 4 | 4.1 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)CC(CCC(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
44314888 | 13684 | 0 | None | - | 1 | Rat | 8.6 | pEC50 | = | 8.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 491 | 8 | 3 | 4 | 3.4 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@@H](C(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1194776 | 13684 | 0 | None | - | 1 | Rat | 8.6 | pEC50 | = | 8.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 491 | 8 | 3 | 4 | 3.4 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@@H](C(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL553290 | 13684 | 0 | None | - | 1 | Rat | 8.6 | pEC50 | = | 8.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 491 | 8 | 3 | 4 | 3.4 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@@H](C(=O)O)c1ccccc12 | 10.1016/S0960-894X(97)00421-6 | |
44314948 | 13463 | 0 | None | - | 1 | Rat | 8.5 | pEC50 | = | 8.5 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 521 | 9 | 2 | 6 | 3.0 | CCOC(=O)[C@H]1CC2(CCN(C(=O)[C@@H](COCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1193173 | 13463 | 0 | None | - | 1 | Rat | 8.5 | pEC50 | = | 8.5 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 521 | 9 | 2 | 6 | 3.0 | CCOC(=O)[C@H]1CC2(CCN(C(=O)[C@@H](COCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL544536 | 13463 | 0 | None | - | 1 | Rat | 8.5 | pEC50 | = | 8.5 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 521 | 9 | 2 | 6 | 3.0 | CCOC(=O)[C@H]1CC2(CCN(C(=O)[C@@H](COCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
44314963 | 13794 | 0 | None | - | 1 | Rat | 7.6 | pEC50 | = | 7.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 544 | 8 | 3 | 5 | 3.9 | CCOC(=O)C[C@H]1CC2(CCN(C(=O)[C@@H](Cc3c[nH]c4ccccc34)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL1195548 | 13794 | 0 | None | - | 1 | Rat | 7.6 | pEC50 | = | 7.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 544 | 8 | 3 | 5 | 3.9 | CCOC(=O)C[C@H]1CC2(CCN(C(=O)[C@@H](Cc3c[nH]c4ccccc34)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL554852 | 13794 | 0 | None | - | 1 | Rat | 7.6 | pEC50 | = | 7.6 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 544 | 8 | 3 | 5 | 3.9 | CCOC(=O)C[C@H]1CC2(CCN(C(=O)[C@@H](Cc3c[nH]c4ccccc34)NC(=O)C(C)(C)N)CC2)c2ccccc21 | 10.1016/S0960-894X(97)00421-6 | |
9872740 | 26465 | 37 | None | - | 1 | Rat | 8.5 | pEC50 | = | 8.5 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 567 | 10 | 4 | 7 | 3.6 | C[C@@H](O)CNC(C)(C)CC(=O)N[C@@H]1CCc2ccccc2N(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)C1=O | 10.1016/S0960-894X(97)00421-6 | |
CHEMBL13600 | 26465 | 37 | None | - | 1 | Rat | 8.5 | pEC50 | = | 8.5 | Functional | Ability to release growth hormone in a rat pituitary cell assayAbility to release growth hormone in a rat pituitary cell assay |
ChEMBL | 567 | 10 | 4 | 7 | 3.6 | C[C@@H](O)CNC(C)(C)CC(=O)N[C@@H]1CCc2ccccc2N(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)C1=O | 10.1016/S0960-894X(97)00421-6 |
Showing 1 to 50 of 77 entries
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Similar- ity
| Common name
| GPCRdb ID | #Vendors
| Reference ligand | Fold selectivity | # Tested GPCRs
| Species | p-value (-log)
| Activity Type
| Activity Relation
| Activity Value
| Assay Type
| Assay Description
| Source | Mol weight | Rot Bonds | H don | H acc | LogP
| Smiles
| DOI |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Assay information
| Chemical information
| |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Similar- ity
| Common name
| GPCRdb ID | #Vendors
| Reference ligand | Fold selectivity | # Tested GPCRs
| Species | p-value (-log)
| Activity Type
| Activity Relation
| Activity Value
| Assay Type
| Assay Description
| Source | Mol weight | Rot Bonds | H don | H acc | LogP
| Smiles
| DOI |
148124 | 207099 | 86 | None | - | 1 | Human | 9.9 | pIC50 | = | 9.9 | Binding | Displacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cellsDisplacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cells |
ChEMBL | 807 | 8 | 5 | 14 | 3.3 | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c4ccccc4)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]12)C3(C)C | 10.1073/pnas.0610860104 | ||
CHEMBL3545252 | 207099 | 86 | None | - | 1 | Human | 9.9 | pIC50 | = | 9.9 | Binding | Displacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cellsDisplacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cells |
ChEMBL | 807 | 8 | 5 | 14 | 3.3 | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c4ccccc4)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]12)C3(C)C | 10.1073/pnas.0610860104 | ||
CHEMBL92 | 207099 | 86 | None | - | 1 | Human | 9.9 | pIC50 | = | 9.9 | Binding | Displacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cellsDisplacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cells |
ChEMBL | 807 | 8 | 5 | 14 | 3.3 | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c4ccccc4)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]12)C3(C)C | 10.1073/pnas.0610860104 | ||
44387407 | 141826 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3354 | 116 | 47 | 46 | -12.4 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)CC(=O)CCc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
91928715 | 141826 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3354 | 116 | 47 | 46 | -12.4 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)CC(=O)CCc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
CHEMBL386366 | 141826 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3354 | 116 | 47 | 46 | -12.4 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)CC(=O)CCc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
1103 | 1791 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | None | 10.1021/jm00088a023 | ||||
CHEMBL440262 | 1791 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | None | 10.1021/jm00088a023 | ||||
CHEMBL385308 | 212348 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(C)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL412221 | 212977 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL269263 | 210783 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6 | Binding | Compound was tested to Inhibit [125I]GRF in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]GRF in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL264522 | 210624 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
44387431 | 96521 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3441 | 119 | 50 | 48 | -15.1 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
91928702 | 96521 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3441 | 119 | 50 | 48 | -15.1 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
CHEMBL262750 | 96521 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3441 | 119 | 50 | 48 | -15.1 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
44387406 | 161243 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3136 | 108 | 44 | 42 | -11.2 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)CC(=O)CCc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
91928713 | 161243 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3136 | 108 | 44 | 42 | -11.2 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)CC(=O)CCc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
CHEMBL411913 | 161243 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3136 | 108 | 44 | 42 | -11.2 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)CC(=O)CCc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
CHEMBL427794 | 213384 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL413014 | 213044 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL414943 | 213163 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL437461 | 213721 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
44387434 | 168986 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3497 | 123 | 50 | 48 | -13.5 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCCCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
91928693 | 168986 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3497 | 123 | 50 | 48 | -13.5 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCCCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
CHEMBL439108 | 168986 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3497 | 123 | 50 | 48 | -13.5 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCCCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
CHEMBL269041 | 210776 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | None | 10.1021/jm00088a023 | ||||
CHEMBL428284 | 213433 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL439306 | 213835 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL427665 | 213363 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL262536 | 210540 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL428135 | 213418 | 17 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
44387430 | 81895 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3469 | 121 | 50 | 48 | -14.3 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
91928698 | 81895 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3469 | 121 | 50 | 48 | -14.3 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
CHEMBL216479 | 81895 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | 3469 | 121 | 50 | 48 | -14.3 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||
CHEMBL438545 | 213775 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL415373 | 213186 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL266658 | 210691 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8.0 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL265167 | 210640 | 13 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8.0 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1c[nH]cn1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O | 10.1021/jm00088a023 | ||||
CHEMBL412558 | 213003 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenatesCompound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | 10.1021/jm00088a023 | ||||
148124 | 207099 | 86 | None | - | 1 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Displacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cellsDisplacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cells |
Drug Central | 807 | 8 | 5 | 14 | 3.3 | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c4ccccc4)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]12)C3(C)C | None | ||
CHEMBL3545252 | 207099 | 86 | None | - | 1 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Displacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cellsDisplacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cells |
Drug Central | 807 | 8 | 5 | 14 | 3.3 | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c4ccccc4)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]12)C3(C)C | None | ||
CHEMBL92 | 207099 | 86 | None | - | 1 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Displacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cellsDisplacement of [125I]JV1-42 from GHRH receptor expressed in human MX1 cells |
Drug Central | 807 | 8 | 5 | 14 | 3.3 | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c4ccccc4)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]12)C3(C)C | None | ||
9114 | 2118 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | Measuring displacement of [<sup>12</sup>5I]JV-1-42 in a radioligand binding assay.Measuring displacement of [<sup>12</sup>5I]JV-1-42 in a radioligand binding assay. |
Guide to Pharmacology | None | None | None | None | 17261802 | ||||
1109 | 2159 | 0 | None | - | 1 | Rat | 10.1 | pKi | = | 10.1 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 10542394 | ||||
1109 | 2159 | 0 | None | - | 1 | Rat | 10.1 | pKi | = | 10.1 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 14755056 | ||||
1109 | 2159 | 0 | None | - | 1 | Rat | 10.1 | pKi | = | 10.1 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9892695 | ||||
1107 | 2157 | 0 | None | - | 1 | Rat | 10.3 | pKi | = | 10.3 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 10542394 | ||||
1107 | 2157 | 0 | None | - | 1 | Rat | 10.3 | pKi | = | 10.3 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 14755056 | ||||
1107 | 2157 | 0 | None | - | 1 | Rat | 10.3 | pKi | = | 10.3 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9892695 | ||||
1110 | 2160 | 0 | None | - | 1 | Rat | 10.1 | pKi | None | 10.1 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9892695 |
Showing 1 to 50 of 69 entries